C34H37ClF3N3O7S — CID 162542161
2-[2-[[4-(4-chloro-2,5-dimethoxyphenyl)-1-(2-cyclohexylethyl)-1,3-thiazol-1-ium-2-yl]carbamoyl]-5,7-dimethylindol-1-yl]acetic acid;2,2,2-trifluoroacetate (PubChem CID 162542161) has the molecular formula C34H37ClF3N3O7S and a molecular weight of 724.20 g/mol. Its IUPAC name is 2-[2-[[4-(4-chloro-2,5-dimethoxyphenyl)-1-(2-cyclohexylethyl)-1,3-thiazol-1-ium-2-yl]carbamoyl]-5,7-dimethylindol-1-yl]acetic acid;2,2,2-trifluoroacetate.
| Compound Name | 2-[2-[[4-(4-chloro-2,5-dimethoxyphenyl)-1-(2-cyclohexylethyl)-1,3-thiazol-1-ium-2-yl]carbamoyl]-5,7-dimethylindol-1-yl]acetic acid;2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 162542161 |
| Molecular Formula | C34H37ClF3N3O7S |
| Molecular Weight | 724.20 g/mol |
| Exact Mass | 723.20 |
| IUPAC Name | 2-[2-[[4-(4-chloro-2,5-dimethoxyphenyl)-1-(2-cyclohexylethyl)-1,3-thiazol-1-ium-2-yl]carbamoyl]-5,7-dimethylindol-1-yl]acetic acid;2,2,2-trifluoroacetate |
| SMILES | COc1cc(-c2c[s+](CCC3CCCCC3)c(NC(=O)c3cc4cc(C)cc(C)c4n3CC(=O)O)n2)c(OC)cc1Cl.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C32H36ClN3O5S.C2HF3O2/c1-19-12-20(2)30-22(13-19)14-26(36(30)17-29(37)38)31(39)35-32-34-25(18-42(32)11-10-21-8-6-5-7-9-21)23-15-28(41-4)24(33)16-27(23)40-3;3-2(4,5)1(6)7/h12-16,18,21H,5-11,17H2,1-4H3,(H-,34,35,37,38,39);(H,6,7) |
| InChIKey | YNZSRBCYPKTYCH-UHFFFAOYSA-N |
| XLogP | 7.35 |
| TPSA | 142.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 724.20 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|