C32H36ClN3O5S — CID 86594539
2-[2-[[4-(4-chloro-2,5-dimethoxyphenyl)-5-(2-cyclohexylethyl)-1,3-thiazol-2-yl]carbamoyl]-3,5-dimethylindol-1-yl]acetic acid (PubChem CID 86594539) has the molecular formula C32H36ClN3O5S and a molecular weight of 610.18 g/mol. Its IUPAC name is 2-[2-[[4-(4-chloro-2,5-dimethoxyphenyl)-5-(2-cyclohexylethyl)-1,3-thiazol-2-yl]carbamoyl]-3,5-dimethylindol-1-yl]acetic acid.
| Compound Name | 2-[2-[[4-(4-chloro-2,5-dimethoxyphenyl)-5-(2-cyclohexylethyl)-1,3-thiazol-2-yl]carbamoyl]-3,5-dimethylindol-1-yl]acetic acid |
|---|---|
| PubChem CID | 86594539 |
| Molecular Formula | C32H36ClN3O5S |
| Molecular Weight | 610.18 g/mol |
| Exact Mass | 609.21 |
| IUPAC Name | 2-[2-[[4-(4-chloro-2,5-dimethoxyphenyl)-5-(2-cyclohexylethyl)-1,3-thiazol-2-yl]carbamoyl]-3,5-dimethylindol-1-yl]acetic acid |
| SMILES | COc1cc(-c2nc(NC(=O)c3c(C)c4cc(C)ccc4n3CC(=O)O)sc2CCC2CCCCC2)c(OC)cc1Cl |
| InChI | InChI=1S/C32H36ClN3O5S/c1-18-10-12-24-21(14-18)19(2)30(36(24)17-28(37)38)31(39)35-32-34-29(22-15-26(41-4)23(33)16-25(22)40-3)27(42-32)13-11-20-8-6-5-7-9-20/h10,12,14-16,20H,5-9,11,13,17H2,1-4H3,(H,37,38)(H,34,35,39) |
| InChIKey | YAGPJAUUNGEFCR-UHFFFAOYSA-N |
| XLogP | 7.90 |
| TPSA | 102.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.18 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|