C10H9F4N5O3 — CID 162543118
1-[2-(aminooxymethyl)-5-fluoro-3-(trifluoromethoxy)phenyl]-4-methyltetrazol-5-one (PubChem CID 162543118) has the molecular formula C10H9F4N5O3 and a molecular weight of 323.21 g/mol. Its IUPAC name is 1-[2-(aminooxymethyl)-5-fluoro-3-(trifluoromethoxy)phenyl]-4-methyltetrazol-5-one.
| Compound Name | 1-[2-(aminooxymethyl)-5-fluoro-3-(trifluoromethoxy)phenyl]-4-methyltetrazol-5-one |
|---|---|
| PubChem CID | 162543118 |
| Molecular Formula | C10H9F4N5O3 |
| Molecular Weight | 323.21 g/mol |
| Exact Mass | 323.06 |
| IUPAC Name | 1-[2-(aminooxymethyl)-5-fluoro-3-(trifluoromethoxy)phenyl]-4-methyltetrazol-5-one |
| SMILES | Cn1nnn(-c2cc(F)cc(OC(F)(F)F)c2CON)c1=O |
| InChI | InChI=1S/C10H9F4N5O3/c1-18-9(20)19(17-16-18)7-2-5(11)3-8(6(7)4-21-15)22-10(12,13)14/h2-3H,4,15H2,1H3 |
| InChIKey | AUJIULDFLFHIQN-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 97.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.21 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|