C15H24F3N3 — CID 162544958
(2E,4E)-5-[(4,5-dimethyl-4,7-diazaspiro[2.5]octan-7-yl)methyl]-6,6,6-trifluorohexa-2,4-dien-3-amine (PubChem CID 162544958) has the molecular formula C15H24F3N3 and a molecular weight of 303.37 g/mol. Its IUPAC name is (2E,4E)-5-[(4,5-dimethyl-4,7-diazaspiro[2.5]octan-7-yl)methyl]-6,6,6-trifluorohexa-2,4-dien-3-amine.
| Compound Name | (2E,4E)-5-[(4,5-dimethyl-4,7-diazaspiro[2.5]octan-7-yl)methyl]-6,6,6-trifluorohexa-2,4-dien-3-amine |
|---|---|
| PubChem CID | 162544958 |
| Molecular Formula | C15H24F3N3 |
| Molecular Weight | 303.37 g/mol |
| Exact Mass | 303.19 |
| IUPAC Name | (2E,4E)-5-[(4,5-dimethyl-4,7-diazaspiro[2.5]octan-7-yl)methyl]-6,6,6-trifluorohexa-2,4-dien-3-amine |
| SMILES | C/C=C(N)\C=C(/CN1CC(C)N(C)C2(CC2)C1)C(F)(F)F |
| InChI | InChI=1S/C15H24F3N3/c1-4-13(19)7-12(15(16,17)18)9-21-8-11(2)20(3)14(10-21)5-6-14/h4,7,11H,5-6,8-10,19H2,1-3H3/b12-7+,13-4+ |
| InChIKey | YCDPHCWZDRGJBV-OGLBZTQXSA-N |
| XLogP | 2.51 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.37 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|