C14H11F3N4O4 — CID 162547594
3-(4-amino-3-oxo-1,4-benzoxazin-6-yl)-1-methyl-6-(trifluoromethyl)pyrimidine-2,4-dione (PubChem CID 162547594) has the molecular formula C14H11F3N4O4 and a molecular weight of 356.26 g/mol. Its IUPAC name is 3-(4-amino-3-oxo-1,4-benzoxazin-6-yl)-1-methyl-6-(trifluoromethyl)pyrimidine-2,4-dione.
| Compound Name | 3-(4-amino-3-oxo-1,4-benzoxazin-6-yl)-1-methyl-6-(trifluoromethyl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 162547594 |
| Molecular Formula | C14H11F3N4O4 |
| Molecular Weight | 356.26 g/mol |
| Exact Mass | 356.07 |
| IUPAC Name | 3-(4-amino-3-oxo-1,4-benzoxazin-6-yl)-1-methyl-6-(trifluoromethyl)pyrimidine-2,4-dione |
| SMILES | Cn1c(C(F)(F)F)cc(=O)n(-c2ccc3c(c2)N(N)C(=O)CO3)c1=O |
| InChI | InChI=1S/C14H11F3N4O4/c1-19-10(14(15,16)17)5-11(22)20(13(19)24)7-2-3-9-8(4-7)21(18)12(23)6-25-9/h2-5H,6,18H2,1H3 |
| InChIKey | PSSLCKYDFIBYOJ-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 99.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.26 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|