C16H10F4N4O5 — CID 15538700
3-(7-fluoro-5-isocyanato-4-methyl-3-oxo-1,4-benzoxazin-6-yl)-1-methyl-6-(trifluoromethyl)pyrimidine-2,4-dione (PubChem CID 15538700) has the molecular formula C16H10F4N4O5 and a molecular weight of 414.27 g/mol. Its IUPAC name is 3-(7-fluoro-5-isocyanato-4-methyl-3-oxo-1,4-benzoxazin-6-yl)-1-methyl-6-(trifluoromethyl)pyrimidine-2,4-dione.
| Compound Name | 3-(7-fluoro-5-isocyanato-4-methyl-3-oxo-1,4-benzoxazin-6-yl)-1-methyl-6-(trifluoromethyl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 15538700 |
| Molecular Formula | C16H10F4N4O5 |
| Molecular Weight | 414.27 g/mol |
| Exact Mass | 414.06 |
| IUPAC Name | 3-(7-fluoro-5-isocyanato-4-methyl-3-oxo-1,4-benzoxazin-6-yl)-1-methyl-6-(trifluoromethyl)pyrimidine-2,4-dione |
| SMILES | CN1C(=O)COc2cc(F)c(-n3c(=O)cc(C(F)(F)F)n(C)c3=O)c(N=C=O)c21 |
| InChI | InChI=1S/C16H10F4N4O5/c1-22-9(16(18,19)20)4-10(26)24(15(22)28)13-7(17)3-8-14(12(13)21-6-25)23(2)11(27)5-29-8/h3-4H,5H2,1-2H3 |
| InChIKey | GKFSKUXBOACUGW-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 102.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.27 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|