C17H12F6N2 — CID 162548025
N-(1H-indol-7-ylmethyl)-3,5-bis(trifluoromethyl)aniline (PubChem CID 162548025) has the molecular formula C17H12F6N2 and a molecular weight of 358.29 g/mol. Its IUPAC name is N-(1H-indol-7-ylmethyl)-3,5-bis(trifluoromethyl)aniline.
| Compound Name | N-(1H-indol-7-ylmethyl)-3,5-bis(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 162548025 |
| Molecular Formula | C17H12F6N2 |
| Molecular Weight | 358.29 g/mol |
| Exact Mass | 358.09 |
| IUPAC Name | N-(1H-indol-7-ylmethyl)-3,5-bis(trifluoromethyl)aniline |
| SMILES | FC(F)(F)c1cc(NCc2cccc3cc[nH]c23)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H12F6N2/c18-16(19,20)12-6-13(17(21,22)23)8-14(7-12)25-9-11-3-1-2-10-4-5-24-15(10)11/h1-8,24-25H,9H2 |
| InChIKey | GGFSFQCKHFHSAG-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 27.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.29 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |