C17H10F6N2 — CID 23578757
N-[3,5-bis(trifluoromethyl)phenyl]-1-(1H-indol-7-yl)methanimine (PubChem CID 23578757) has the molecular formula C17H10F6N2 and a molecular weight of 356.27 g/mol. Its IUPAC name is N-[3,5-bis(trifluoromethyl)phenyl]-1-(1H-indol-7-yl)methanimine.
| Compound Name | N-[3,5-bis(trifluoromethyl)phenyl]-1-(1H-indol-7-yl)methanimine |
|---|---|
| PubChem CID | 23578757 |
| Molecular Formula | C17H10F6N2 |
| Molecular Weight | 356.27 g/mol |
| Exact Mass | 356.07 |
| IUPAC Name | N-[3,5-bis(trifluoromethyl)phenyl]-1-(1H-indol-7-yl)methanimine |
| SMILES | FC(F)(F)c1cc(/N=C/c2cccc3cc[nH]c23)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H10F6N2/c18-16(19,20)12-6-13(17(21,22)23)8-14(7-12)25-9-11-3-1-2-10-4-5-24-15(10)11/h1-9,24H/b25-9+ |
| InChIKey | USCNCWVSOUKDTC-YCPBAFNGSA-N |
| XLogP | 5.96 |
| TPSA | 28.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.27 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|