C26H32F4N6O3 — CID 162548380
tert-butyl (2S,3S)-3-[[5-[diazenyl-(2,2,2-trifluoroethanimidoyl)amino]-2-(fluoromethoxy)phenyl]methylamino]-2-phenylpiperidine-1-carboxylate (PubChem CID 162548380) has the molecular formula C26H32F4N6O3 and a molecular weight of 552.57 g/mol. Its IUPAC name is tert-butyl (2S,3S)-3-[[5-[diazenyl-(2,2,2-trifluoroethanimidoyl)amino]-2-(fluoromethoxy)phenyl]methylamino]-2-phenylpiperidine-1-carboxylate.
| Compound Name | tert-butyl (2S,3S)-3-[[5-[diazenyl-(2,2,2-trifluoroethanimidoyl)amino]-2-(fluoromethoxy)phenyl]methylamino]-2-phenylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 162548380 |
| Molecular Formula | C26H32F4N6O3 |
| Molecular Weight | 552.57 g/mol |
| Exact Mass | 552.25 |
| IUPAC Name | tert-butyl (2S,3S)-3-[[5-[diazenyl-(2,2,2-trifluoroethanimidoyl)amino]-2-(fluoromethoxy)phenyl]methylamino]-2-phenylpiperidine-1-carboxylate |
| SMILES | [H]/N=N/N(/C(=N/[H])C(F)(F)F)c1ccc(OCF)c(CN[C@H]2CCCN(C(=O)OC(C)(C)C)[C@H]2c2ccccc2)c1 |
| InChI | InChI=1S/C26H32F4N6O3/c1-25(2,3)39-24(37)35-13-7-10-20(22(35)17-8-5-4-6-9-17)33-15-18-14-19(11-12-21(18)38-16-27)36(34-32)23(31)26(28,29)30/h4-6,8-9,11-12,14,20,22,31-33H,7,10,13,15-16H2,1-3H3/b31-23+,34-32+/t20-,22-/m0/s1 |
| InChIKey | YLUWWKWUQFTOTQ-CZVGTLLVSA-N |
| XLogP | 6.51 |
| TPSA | 114.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.57 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|