C27H31F5N2O3 — CID 70001040
tert-butyl (2S,3S)-3-[[2-methoxy-5-(1,1,3,3,3-pentafluoroprop-1-en-2-yl)phenyl]methylamino]-2-phenylpiperidine-1-carboxylate (PubChem CID 70001040) has the molecular formula C27H31F5N2O3 and a molecular weight of 526.55 g/mol. Its IUPAC name is tert-butyl (2S,3S)-3-[[2-methoxy-5-(1,1,3,3,3-pentafluoroprop-1-en-2-yl)phenyl]methylamino]-2-phenylpiperidine-1-carboxylate.
| Compound Name | tert-butyl (2S,3S)-3-[[2-methoxy-5-(1,1,3,3,3-pentafluoroprop-1-en-2-yl)phenyl]methylamino]-2-phenylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 70001040 |
| Molecular Formula | C27H31F5N2O3 |
| Molecular Weight | 526.55 g/mol |
| Exact Mass | 526.23 |
| IUPAC Name | tert-butyl (2S,3S)-3-[[2-methoxy-5-(1,1,3,3,3-pentafluoroprop-1-en-2-yl)phenyl]methylamino]-2-phenylpiperidine-1-carboxylate |
| SMILES | COc1ccc(C(=C(F)F)C(F)(F)F)cc1CN[C@H]1CCCN(C(=O)OC(C)(C)C)[C@H]1c1ccccc1 |
| InChI | InChI=1S/C27H31F5N2O3/c1-26(2,3)37-25(35)34-14-8-11-20(23(34)17-9-6-5-7-10-17)33-16-19-15-18(12-13-21(19)36-4)22(24(28)29)27(30,31)32/h5-7,9-10,12-13,15,20,23,33H,8,11,14,16H2,1-4H3/t20-,23-/m0/s1 |
| InChIKey | ATOSDRGWPAXLDC-REWPJTCUSA-N |
| XLogP | 7.10 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.55 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |