C11H8Cl2F3N3O2 — CID 162549210
[3-chloro-5-(trifluoromethyl)-2-pyridinyl] (Z)-3-(carbonochloridoylamino)but-2-enimidate (PubChem CID 162549210) has the molecular formula C11H8Cl2F3N3O2 and a molecular weight of 342.10 g/mol. Its IUPAC name is [3-chloro-5-(trifluoromethyl)-2-pyridinyl] (Z)-3-(carbonochloridoylamino)but-2-enimidate.
| Compound Name | [3-chloro-5-(trifluoromethyl)-2-pyridinyl] (Z)-3-(carbonochloridoylamino)but-2-enimidate |
|---|---|
| PubChem CID | 162549210 |
| Molecular Formula | C11H8Cl2F3N3O2 |
| Molecular Weight | 342.10 g/mol |
| Exact Mass | 340.99 |
| IUPAC Name | [3-chloro-5-(trifluoromethyl)-2-pyridinyl] (Z)-3-(carbonochloridoylamino)but-2-enimidate |
| SMILES | [H]/N=C(\C=C(\C)NC(=O)Cl)Oc1ncc(C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C11H8Cl2F3N3O2/c1-5(19-10(13)20)2-8(17)21-9-7(12)3-6(4-18-9)11(14,15)16/h2-4,17H,1H3,(H,19,20)/b5-2-,17-8+ |
| InChIKey | SUIDMNOGGNHURM-AUZWGAGXSA-N |
| XLogP | 3.96 |
| TPSA | 75.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.10 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|