C15H17F3N4O4 — CID 154536196
[2-nitro-4-(trifluoromethyl)phenyl] (Z)-3-(propan-2-ylcarbamoylamino)but-2-enimidate (PubChem CID 154536196) has the molecular formula C15H17F3N4O4 and a molecular weight of 374.32 g/mol. Its IUPAC name is [2-nitro-4-(trifluoromethyl)phenyl] (Z)-3-(propan-2-ylcarbamoylamino)but-2-enimidate.
| Compound Name | [2-nitro-4-(trifluoromethyl)phenyl] (Z)-3-(propan-2-ylcarbamoylamino)but-2-enimidate |
|---|---|
| PubChem CID | 154536196 |
| Molecular Formula | C15H17F3N4O4 |
| Molecular Weight | 374.32 g/mol |
| Exact Mass | 374.12 |
| IUPAC Name | [2-nitro-4-(trifluoromethyl)phenyl] (Z)-3-(propan-2-ylcarbamoylamino)but-2-enimidate |
| SMILES | [H]/N=C(\C=C(\C)NC(=O)NC(C)C)Oc1ccc(C(F)(F)F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H17F3N4O4/c1-8(2)20-14(23)21-9(3)6-13(19)26-12-5-4-10(15(16,17)18)7-11(12)22(24)25/h4-8,19H,1-3H3,(H2,20,21,23)/b9-6-,19-13+ |
| InChIKey | FAPIUMHNCJJVKV-ZRNUZKMPSA-N |
| XLogP | 3.58 |
| TPSA | 117.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.32 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|