C17H23F3N5O4+ — CID 8593075
2-[4-[2-nitro-4-(trifluoromethyl)phenyl]piperazin-1-ium-1-yl]-N-(propan-2-ylcarbamoyl)acetamide (PubChem CID 8593075) has the molecular formula C17H23F3N5O4+ and a molecular weight of 418.40 g/mol. Its IUPAC name is 2-[4-[2-nitro-4-(trifluoromethyl)phenyl]piperazin-1-ium-1-yl]-N-(propan-2-ylcarbamoyl)acetamide.
| Compound Name | 2-[4-[2-nitro-4-(trifluoromethyl)phenyl]piperazin-1-ium-1-yl]-N-(propan-2-ylcarbamoyl)acetamide |
|---|---|
| PubChem CID | 8593075 |
| Molecular Formula | C17H23F3N5O4+ |
| Molecular Weight | 418.40 g/mol |
| Exact Mass | 418.17 |
| IUPAC Name | 2-[4-[2-nitro-4-(trifluoromethyl)phenyl]piperazin-1-ium-1-yl]-N-(propan-2-ylcarbamoyl)acetamide |
| SMILES | CC(C)NC(=O)NC(=O)C[NH+]1CCN(c2ccc(C(F)(F)F)cc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C17H22F3N5O4/c1-11(2)21-16(27)22-15(26)10-23-5-7-24(8-6-23)13-4-3-12(17(18,19)20)9-14(13)25(28)29/h3-4,9,11H,5-8,10H2,1-2H3,(H2,21,22,26,27)/p+1 |
| InChIKey | HPMQJSHFUJOQIV-UHFFFAOYSA-O |
| XLogP | 0.55 |
| TPSA | 109.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.40 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|