C13H15F3N3O3- — CID 163569920
[(Z)-3-amino-2-ethyl-1-[2-nitro-4-(trifluoromethyl)phenoxy]but-2-enyl]azanide (PubChem CID 163569920) has the molecular formula C13H15F3N3O3- and a molecular weight of 318.27 g/mol. Its IUPAC name is [(Z)-3-amino-2-ethyl-1-[2-nitro-4-(trifluoromethyl)phenoxy]but-2-enyl]azanide.
| Compound Name | [(Z)-3-amino-2-ethyl-1-[2-nitro-4-(trifluoromethyl)phenoxy]but-2-enyl]azanide |
|---|---|
| PubChem CID | 163569920 |
| Molecular Formula | C13H15F3N3O3- |
| Molecular Weight | 318.27 g/mol |
| Exact Mass | 318.11 |
| IUPAC Name | [(Z)-3-amino-2-ethyl-1-[2-nitro-4-(trifluoromethyl)phenoxy]but-2-enyl]azanide |
| SMILES | CC/C(=C(\C)N)C([NH-])Oc1ccc(C(F)(F)F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H15F3N3O3/c1-3-9(7(2)17)12(18)22-11-5-4-8(13(14,15)16)6-10(11)19(20)21/h4-6,12,18H,3,17H2,1-2H3/q-1/b9-7- |
| InChIKey | FYLRSGHXGLHNAT-CLFYSBASSA-N |
| XLogP | 4.01 |
| TPSA | 102.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.27 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|