C19H16F3N3O3 — CID 162549666
4-[(7aR)-4,7-dimethyl-7a-(methylamino)-1,3-dioxo-3aH-4,7-epoxyisoindol-2-yl]-2-(trifluoromethyl)benzonitrile (PubChem CID 162549666) has the molecular formula C19H16F3N3O3 and a molecular weight of 391.35 g/mol. Its IUPAC name is 4-[(7aR)-4,7-dimethyl-7a-(methylamino)-1,3-dioxo-3aH-4,7-epoxyisoindol-2-yl]-2-(trifluoromethyl)benzonitrile.
| Compound Name | 4-[(7aR)-4,7-dimethyl-7a-(methylamino)-1,3-dioxo-3aH-4,7-epoxyisoindol-2-yl]-2-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 162549666 |
| Molecular Formula | C19H16F3N3O3 |
| Molecular Weight | 391.35 g/mol |
| Exact Mass | 391.11 |
| IUPAC Name | 4-[(7aR)-4,7-dimethyl-7a-(methylamino)-1,3-dioxo-3aH-4,7-epoxyisoindol-2-yl]-2-(trifluoromethyl)benzonitrile |
| SMILES | CN[C@]12C(=O)N(c3ccc(C#N)c(C(F)(F)F)c3)C(=O)C1C1(C)C=CC2(C)O1 |
| InChI | InChI=1S/C19H16F3N3O3/c1-16-6-7-17(2,28-16)18(24-3)13(16)14(26)25(15(18)27)11-5-4-10(9-23)12(8-11)19(20,21)22/h4-8,13,24H,1-3H3/t13?,16?,17?,18-/m0/s1 |
| InChIKey | LCUPVQYIXNMCRL-NEGSROCKSA-N |
| XLogP | 2.14 |
| TPSA | 82.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.35 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|