C43H26F4I2N2 — CID 162551778
2-(difluoromethyl)-6-N,12-N-bis(4-fluorophenyl)-6-N,12-N-bis(4-iodophenyl)chrysene-6,12-diamine (PubChem CID 162551778) has the molecular formula C43H26F4I2N2 and a molecular weight of 900.50 g/mol. Its IUPAC name is 2-(difluoromethyl)-6-N,12-N-bis(4-fluorophenyl)-6-N,12-N-bis(4-iodophenyl)chrysene-6,12-diamine.
| Compound Name | 2-(difluoromethyl)-6-N,12-N-bis(4-fluorophenyl)-6-N,12-N-bis(4-iodophenyl)chrysene-6,12-diamine |
|---|---|
| PubChem CID | 162551778 |
| Molecular Formula | C43H26F4I2N2 |
| Molecular Weight | 900.50 g/mol |
| Exact Mass | 900.01 |
| IUPAC Name | 2-(difluoromethyl)-6-N,12-N-bis(4-fluorophenyl)-6-N,12-N-bis(4-iodophenyl)chrysene-6,12-diamine |
| SMILES | Fc1ccc(N(c2ccc(I)cc2)c2cc3c4ccc(C(F)F)cc4c(N(c4ccc(F)cc4)c4ccc(I)cc4)cc3c3ccccc23)cc1 |
| InChI | InChI=1S/C43H26F4I2N2/c44-27-6-14-31(15-7-27)50(33-18-10-29(48)11-19-33)41-24-39-36-22-5-26(43(46)47)23-40(36)42(25-38(39)35-3-1-2-4-37(35)41)51(32-16-8-28(45)9-17-32)34-20-12-30(49)13-21-34/h1-25,43H |
| InChIKey | HHAAVQWAOKLMJP-UHFFFAOYSA-N |
| XLogP | 14.51 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 900.50 |
| LogP ≤ 5 | 14.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|