C26H24F5N3O7S — CID 162554738
(E)-4-[(3R)-3-[[4-(1,1-difluoroprop-2-enyl)phenyl]methylcarbamoyl]-4-[4-(trifluoromethoxy)phenyl]sulfonylpiperazin-1-yl]-4-oxobut-2-enoic acid (PubChem CID 162554738) has the molecular formula C26H24F5N3O7S and a molecular weight of 617.55 g/mol. Its IUPAC name is (E)-4-[(3R)-3-[[4-(1,1-difluoroprop-2-enyl)phenyl]methylcarbamoyl]-4-[4-(trifluoromethoxy)phenyl]sulfonylpiperazin-1-yl]-4-oxobut-2-enoic acid.
| Compound Name | (E)-4-[(3R)-3-[[4-(1,1-difluoroprop-2-enyl)phenyl]methylcarbamoyl]-4-[4-(trifluoromethoxy)phenyl]sulfonylpiperazin-1-yl]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 162554738 |
| Molecular Formula | C26H24F5N3O7S |
| Molecular Weight | 617.55 g/mol |
| Exact Mass | 617.13 |
| IUPAC Name | (E)-4-[(3R)-3-[[4-(1,1-difluoroprop-2-enyl)phenyl]methylcarbamoyl]-4-[4-(trifluoromethoxy)phenyl]sulfonylpiperazin-1-yl]-4-oxobut-2-enoic acid |
| SMILES | C=CC(F)(F)c1ccc(CNC(=O)[C@H]2CN(C(=O)/C=C/C(=O)O)CCN2S(=O)(=O)c2ccc(OC(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C26H24F5N3O7S/c1-2-25(27,28)18-5-3-17(4-6-18)15-32-24(38)21-16-33(22(35)11-12-23(36)37)13-14-34(21)42(39,40)20-9-7-19(8-10-20)41-26(29,30)31/h2-12,21H,1,13-16H2,(H,32,38)(H,36,37)/b12-11+/t21-/m1/s1 |
| InChIKey | GYDNTGDNMQSVNC-RJRNSMGGSA-N |
| XLogP | 3.02 |
| TPSA | 133.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.55 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|