C29H34F3N5O5S — CID 89217079
(3R)-1-N-[(1Z,3E)-1-aminohexa-1,3,5-trien-3-yl]-3-N-[(4-propan-2-ylphenyl)methyl]-4-[4-(trifluoromethoxy)phenyl]sulfonylpiperazine-1,3-dicarboxamide (PubChem CID 89217079) has the molecular formula C29H34F3N5O5S and a molecular weight of 621.68 g/mol. Its IUPAC name is (3R)-1-N-[(1Z,3E)-1-aminohexa-1,3,5-trien-3-yl]-3-N-[(4-propan-2-ylphenyl)methyl]-4-[4-(trifluoromethoxy)phenyl]sulfonylpiperazine-1,3-dicarboxamide.
| Compound Name | (3R)-1-N-[(1Z,3E)-1-aminohexa-1,3,5-trien-3-yl]-3-N-[(4-propan-2-ylphenyl)methyl]-4-[4-(trifluoromethoxy)phenyl]sulfonylpiperazine-1,3-dicarboxamide |
|---|---|
| PubChem CID | 89217079 |
| Molecular Formula | C29H34F3N5O5S |
| Molecular Weight | 621.68 g/mol |
| Exact Mass | 621.22 |
| IUPAC Name | (3R)-1-N-[(1Z,3E)-1-aminohexa-1,3,5-trien-3-yl]-3-N-[(4-propan-2-ylphenyl)methyl]-4-[4-(trifluoromethoxy)phenyl]sulfonylpiperazine-1,3-dicarboxamide |
| SMILES | C=C/C=C(\C=C/N)NC(=O)N1CCN(S(=O)(=O)c2ccc(OC(F)(F)F)cc2)[C@@H](C(=O)NCc2ccc(C(C)C)cc2)C1 |
| InChI | InChI=1S/C29H34F3N5O5S/c1-4-5-23(14-15-33)35-28(39)36-16-17-37(43(40,41)25-12-10-24(11-13-25)42-29(30,31)32)26(19-36)27(38)34-18-21-6-8-22(9-7-21)20(2)3/h4-15,20,26H,1,16-19,33H2,2-3H3,(H,34,38)(H,35,39)/b15-14-,23-5+/t26-/m1/s1 |
| InChIKey | HLNFVLNJKWKQHW-YIAIJRBZSA-N |
| XLogP | 3.95 |
| TPSA | 134.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.68 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|