C19H17ClF3N5OS — CID 162555058
N-[6-amino-7-methanimidoyl-4-(trifluoromethyl)-1,3-benzothiazol-2-yl]-2-(4-chloroanilino)-2-methylpropanamide (PubChem CID 162555058) has the molecular formula C19H17ClF3N5OS and a molecular weight of 455.89 g/mol. Its IUPAC name is N-[6-amino-7-methanimidoyl-4-(trifluoromethyl)-1,3-benzothiazol-2-yl]-2-(4-chloroanilino)-2-methylpropanamide.
| Compound Name | N-[6-amino-7-methanimidoyl-4-(trifluoromethyl)-1,3-benzothiazol-2-yl]-2-(4-chloroanilino)-2-methylpropanamide |
|---|---|
| PubChem CID | 162555058 |
| Molecular Formula | C19H17ClF3N5OS |
| Molecular Weight | 455.89 g/mol |
| Exact Mass | 455.08 |
| IUPAC Name | N-[6-amino-7-methanimidoyl-4-(trifluoromethyl)-1,3-benzothiazol-2-yl]-2-(4-chloroanilino)-2-methylpropanamide |
| SMILES | [H]/N=C/c1c(N)cc(C(F)(F)F)c2nc(NC(=O)C(C)(C)Nc3ccc(Cl)cc3)sc12 |
| InChI | InChI=1S/C19H17ClF3N5OS/c1-18(2,28-10-5-3-9(20)4-6-10)16(29)27-17-26-14-12(19(21,22)23)7-13(25)11(8-24)15(14)30-17/h3-8,24,28H,25H2,1-2H3,(H,26,27,29)/b24-8+ |
| InChIKey | OPNCFCQGSBWLNX-KTZMUZOWSA-N |
| XLogP | 5.38 |
| TPSA | 103.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.89 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|