C15H17ClF3N — CID 162555763
(2E,4E)-5-chloro-N-[2-[4-(trifluoromethyl)phenyl]ethyl]hexa-2,4-dien-2-amine (PubChem CID 162555763) has the molecular formula C15H17ClF3N and a molecular weight of 303.76 g/mol. Its IUPAC name is (2E,4E)-5-chloro-N-[2-[4-(trifluoromethyl)phenyl]ethyl]hexa-2,4-dien-2-amine.
| Compound Name | (2E,4E)-5-chloro-N-[2-[4-(trifluoromethyl)phenyl]ethyl]hexa-2,4-dien-2-amine |
|---|---|
| PubChem CID | 162555763 |
| Molecular Formula | C15H17ClF3N |
| Molecular Weight | 303.76 g/mol |
| Exact Mass | 303.10 |
| IUPAC Name | (2E,4E)-5-chloro-N-[2-[4-(trifluoromethyl)phenyl]ethyl]hexa-2,4-dien-2-amine |
| SMILES | C/C(Cl)=C\C=C(/C)NCCc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C15H17ClF3N/c1-11(16)3-4-12(2)20-10-9-13-5-7-14(8-6-13)15(17,18)19/h3-8,20H,9-10H2,1-2H3/b11-3+,12-4+ |
| InChIKey | FCFPKMGIANXIIC-HMMKTVFPSA-N |
| XLogP | 4.88 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.76 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|