C26H28ClF3IN3O — CID 162557909
N-[2-(azepan-1-yl)-2-[5-ethyl-6-(trifluoromethyl)-1λ3-iodacyclohexa-1,3,5-trien-3-yl]ethyl]-2-chloroquinoline-5-carboxamide (PubChem CID 162557909) has the molecular formula C26H28ClF3IN3O and a molecular weight of 617.88 g/mol. Its IUPAC name is N-[2-(azepan-1-yl)-2-[5-ethyl-6-(trifluoromethyl)-1λ3-iodacyclohexa-1,3,5-trien-3-yl]ethyl]-2-chloroquinoline-5-carboxamide.
| Compound Name | N-[2-(azepan-1-yl)-2-[5-ethyl-6-(trifluoromethyl)-1λ3-iodacyclohexa-1,3,5-trien-3-yl]ethyl]-2-chloroquinoline-5-carboxamide |
|---|---|
| PubChem CID | 162557909 |
| Molecular Formula | C26H28ClF3IN3O |
| Molecular Weight | 617.88 g/mol |
| Exact Mass | 617.09 |
| IUPAC Name | N-[2-(azepan-1-yl)-2-[5-ethyl-6-(trifluoromethyl)-1λ3-iodacyclohexa-1,3,5-trien-3-yl]ethyl]-2-chloroquinoline-5-carboxamide |
| SMILES | CCC1=C(C(F)(F)F)I=CC(C(CNC(=O)c2cccc3nc(Cl)ccc23)N2CCCCCC2)=C1 |
| InChI | InChI=1S/C26H28ClF3IN3O/c1-2-17-14-18(15-31-24(17)26(28,29)30)22(34-12-5-3-4-6-13-34)16-32-25(35)20-8-7-9-21-19(20)10-11-23(27)33-21/h7-11,14-15,22H,2-6,12-13,16H2,1H3,(H,32,35) |
| InChIKey | WCGPAANNIFNFSQ-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.88 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|