C23H20ClF5N4O — CID 58228407
1-(2-chloroquinolin-5-yl)-4-(4,4-difluoropiperidin-1-yl)-4-[2-(trifluoromethyl)pyrimidin-5-yl]butan-1-one (PubChem CID 58228407) has the molecular formula C23H20ClF5N4O and a molecular weight of 498.88 g/mol. Its IUPAC name is 1-(2-chloroquinolin-5-yl)-4-(4,4-difluoropiperidin-1-yl)-4-[2-(trifluoromethyl)pyrimidin-5-yl]butan-1-one.
| Compound Name | 1-(2-chloroquinolin-5-yl)-4-(4,4-difluoropiperidin-1-yl)-4-[2-(trifluoromethyl)pyrimidin-5-yl]butan-1-one |
|---|---|
| PubChem CID | 58228407 |
| Molecular Formula | C23H20ClF5N4O |
| Molecular Weight | 498.88 g/mol |
| Exact Mass | 498.12 |
| IUPAC Name | 1-(2-chloroquinolin-5-yl)-4-(4,4-difluoropiperidin-1-yl)-4-[2-(trifluoromethyl)pyrimidin-5-yl]butan-1-one |
| SMILES | O=C(CCC(c1cnc(C(F)(F)F)nc1)N1CCC(F)(F)CC1)c1cccc2nc(Cl)ccc12 |
| InChI | InChI=1S/C23H20ClF5N4O/c24-20-7-4-15-16(2-1-3-17(15)32-20)19(34)6-5-18(33-10-8-22(25,26)9-11-33)14-12-30-21(31-13-14)23(27,28)29/h1-4,7,12-13,18H,5-6,8-11H2 |
| InChIKey | SNXAOOLDCLDORM-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 58.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.88 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|