C20H16F3N5O3 — CID 162562678
N-[3-[(4S)-2-amino-6-(fluoromethyl)-4-methyl-1,3-oxazin-4-yl]-4-hydroxyphenyl]-5-cyano-3-(difluoromethyl)pyridine-2-carboxamide (PubChem CID 162562678) has the molecular formula C20H16F3N5O3 and a molecular weight of 431.37 g/mol. Its IUPAC name is N-[3-[(4S)-2-amino-6-(fluoromethyl)-4-methyl-1,3-oxazin-4-yl]-4-hydroxyphenyl]-5-cyano-3-(difluoromethyl)pyridine-2-carboxamide.
| Compound Name | N-[3-[(4S)-2-amino-6-(fluoromethyl)-4-methyl-1,3-oxazin-4-yl]-4-hydroxyphenyl]-5-cyano-3-(difluoromethyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 162562678 |
| Molecular Formula | C20H16F3N5O3 |
| Molecular Weight | 431.37 g/mol |
| Exact Mass | 431.12 |
| IUPAC Name | N-[3-[(4S)-2-amino-6-(fluoromethyl)-4-methyl-1,3-oxazin-4-yl]-4-hydroxyphenyl]-5-cyano-3-(difluoromethyl)pyridine-2-carboxamide |
| SMILES | C[C@@]1(c2cc(NC(=O)c3ncc(C#N)cc3C(F)F)ccc2O)C=C(CF)OC(N)=N1 |
| InChI | InChI=1S/C20H16F3N5O3/c1-20(6-12(7-21)31-19(25)28-20)14-5-11(2-3-15(14)29)27-18(30)16-13(17(22)23)4-10(8-24)9-26-16/h2-6,9,17,29H,7H2,1H3,(H2,25,28)(H,27,30)/t20-/m0/s1 |
| InChIKey | BWTCUHURFHFKMS-FQEVSTJZSA-N |
| XLogP | 3.26 |
| TPSA | 133.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.37 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|