C10H8F5N3 — CID 162563501
2,6-difluoro-5-[1-methyl-4-(trifluoromethyl)imidazol-2-yl]-3,4-dihydropyridine (PubChem CID 162563501) has the molecular formula C10H8F5N3 and a molecular weight of 265.19 g/mol. Its IUPAC name is 2,6-difluoro-5-[1-methyl-4-(trifluoromethyl)imidazol-2-yl]-3,4-dihydropyridine.
| Compound Name | 2,6-difluoro-5-[1-methyl-4-(trifluoromethyl)imidazol-2-yl]-3,4-dihydropyridine |
|---|---|
| PubChem CID | 162563501 |
| Molecular Formula | C10H8F5N3 |
| Molecular Weight | 265.19 g/mol |
| Exact Mass | 265.06 |
| IUPAC Name | 2,6-difluoro-5-[1-methyl-4-(trifluoromethyl)imidazol-2-yl]-3,4-dihydropyridine |
| SMILES | Cn1cc(C(F)(F)F)nc1C1=C(F)N=C(F)CC1 |
| InChI | InChI=1S/C10H8F5N3/c1-18-4-6(10(13,14)15)16-9(18)5-2-3-7(11)17-8(5)12/h4H,2-3H2,1H3 |
| InChIKey | JKFFQISJSUKZEX-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 30.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.19 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|