C11H7F8IrN2- — CID 59005654
1,5-dimethyl-2-(3,3,4,4,5,5,6,6-octafluorocyclohexen-1-yl)imidazole;iridium (PubChem CID 59005654) has the molecular formula C11H7F8IrN2- and a molecular weight of 511.39 g/mol. Its IUPAC name is 1,5-dimethyl-2-(3,3,4,4,5,5,6,6-octafluorocyclohexen-1-yl)imidazole;iridium.
| Compound Name | 1,5-dimethyl-2-(3,3,4,4,5,5,6,6-octafluorocyclohexen-1-yl)imidazole;iridium |
|---|---|
| PubChem CID | 59005654 |
| Molecular Formula | C11H7F8IrN2- |
| Molecular Weight | 511.39 g/mol |
| Exact Mass | 512.01 |
| IUPAC Name | 1,5-dimethyl-2-(3,3,4,4,5,5,6,6-octafluorocyclohexen-1-yl)imidazole;iridium |
| SMILES | Cc1cnc(C2=[C-]C(F)(F)C(F)(F)C(F)(F)C2(F)F)n1C.[Ir] |
| InChI | InChI=1S/C11H7F8N2.Ir/c1-5-4-20-7(21(5)2)6-3-8(12,13)10(16,17)11(18,19)9(6,14)15;/h4H,1-2H3;/q-1; |
| InChIKey | JAGHXOIUFASSAN-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.39 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|