C15H20F3N3 — CID 164558031
N-[2-(trifluoromethyl)-5,6-dihydroimidazo[1,2-a]pyridin-5-yl]heptan-4-imine (PubChem CID 164558031) has the molecular formula C15H20F3N3 and a molecular weight of 299.34 g/mol. Its IUPAC name is N-[2-(trifluoromethyl)-5,6-dihydroimidazo[1,2-a]pyridin-5-yl]heptan-4-imine.
| Compound Name | N-[2-(trifluoromethyl)-5,6-dihydroimidazo[1,2-a]pyridin-5-yl]heptan-4-imine |
|---|---|
| PubChem CID | 164558031 |
| Molecular Formula | C15H20F3N3 |
| Molecular Weight | 299.34 g/mol |
| Exact Mass | 299.16 |
| IUPAC Name | N-[2-(trifluoromethyl)-5,6-dihydroimidazo[1,2-a]pyridin-5-yl]heptan-4-imine |
| SMILES | CCCC(CCC)=NC1CC=Cc2nc(C(F)(F)F)cn21 |
| InChI | InChI=1S/C15H20F3N3/c1-3-6-11(7-4-2)19-13-8-5-9-14-20-12(10-21(13)14)15(16,17)18/h5,9-10,13H,3-4,6-8H2,1-2H3 |
| InChIKey | GVFNTVXZTGCTGI-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 30.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.34 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|