C11H8F8N2 — CID 59005655
1,5-dimethyl-2-(3,3,4,4,5,5,6,6-octafluorocyclohexen-1-yl)imidazole (PubChem CID 59005655) has the molecular formula C11H8F8N2 and a molecular weight of 320.18 g/mol. Its IUPAC name is 1,5-dimethyl-2-(3,3,4,4,5,5,6,6-octafluorocyclohexen-1-yl)imidazole.
| Compound Name | 1,5-dimethyl-2-(3,3,4,4,5,5,6,6-octafluorocyclohexen-1-yl)imidazole |
|---|---|
| PubChem CID | 59005655 |
| Molecular Formula | C11H8F8N2 |
| Molecular Weight | 320.18 g/mol |
| Exact Mass | 320.06 |
| IUPAC Name | 1,5-dimethyl-2-(3,3,4,4,5,5,6,6-octafluorocyclohexen-1-yl)imidazole |
| SMILES | Cc1cnc(C2=CC(F)(F)C(F)(F)C(F)(F)C2(F)F)n1C |
| InChI | InChI=1S/C11H8F8N2/c1-5-4-20-7(21(5)2)6-3-8(12,13)10(16,17)11(18,19)9(6,14)15/h3-4H,1-2H3 |
| InChIKey | YXASFXBRJWVEQP-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.18 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|