C27H26F3N3O2 — CID 162564900
2-methyl-17'-[3-(trifluoromethoxy)phenyl]spiro[1,2,4-oxadiazole-5,2'-tricyclo[12.4.0.05,10]octadeca-1(14),5,7,9,15,17-hexaene]-3-amine (PubChem CID 162564900) has the molecular formula C27H26F3N3O2 and a molecular weight of 481.52 g/mol. Its IUPAC name is 2-methyl-17'-[3-(trifluoromethoxy)phenyl]spiro[1,2,4-oxadiazole-5,2'-tricyclo[12.4.0.05,10]octadeca-1(14),5,7,9,15,17-hexaene]-3-amine.
| Compound Name | 2-methyl-17'-[3-(trifluoromethoxy)phenyl]spiro[1,2,4-oxadiazole-5,2'-tricyclo[12.4.0.05,10]octadeca-1(14),5,7,9,15,17-hexaene]-3-amine |
|---|---|
| PubChem CID | 162564900 |
| Molecular Formula | C27H26F3N3O2 |
| Molecular Weight | 481.52 g/mol |
| Exact Mass | 481.20 |
| IUPAC Name | 2-methyl-17'-[3-(trifluoromethoxy)phenyl]spiro[1,2,4-oxadiazole-5,2'-tricyclo[12.4.0.05,10]octadeca-1(14),5,7,9,15,17-hexaene]-3-amine |
| SMILES | CN1OC2(CCc3ccccc3CCCc3ccc(-c4cccc(OC(F)(F)F)c4)cc32)N=C1N |
| InChI | InChI=1S/C27H26F3N3O2/c1-33-25(31)32-26(35-33)15-14-19-7-3-2-6-18(19)8-4-9-20-12-13-22(17-24(20)26)21-10-5-11-23(16-21)34-27(28,29)30/h2-3,5-7,10-13,16-17H,4,8-9,14-15H2,1H3,(H2,31,32) |
| InChIKey | HRDWPJUIZOUAFN-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 60.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.52 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |