About CID 58197029
CID 58197029 (PubChem CID 58197029) has the molecular formula C28H26F3N3O2
and a molecular weight of 493.53 g/mol.
Molecular Properties
| Compound Name | CID 58197029 |
| PubChem CID | 58197029 |
| Molecular Formula | C28H26F3N3O2 |
| Molecular Weight | 493.53 g/mol |
| Exact Mass | 493.20 |
| IUPAC Name | — |
| SMILES | CN1OC2(N=C1N)c1cc(-c3cccc(OC(F)(F)F)c3)ccc1CC21CCc2ccccc2CC1 |
| InChI | InChI=1S/C28H26F3N3O2/c1-34-25(32)33-27(36-34)24-16-21(20-7-4-8-23(15-20)35-28(29,30)31)9-10-22(24)17-26(27)13-11-18-5-2-3-6-19(18)12-14-26/h2-10,15-16H,11-14,17H2,1H3,(H2,32,33) |
| InChIKey | SEJLBMNPGJWZKM-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 60.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 493.53 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze CID 58197029 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 58197029?
The IUPAC name of CID 58197029 (CID 58197029) is not available.
What is the SMILES notation for CID 58197029?
The canonical SMILES for CID 58197029 is CN1OC2(N=C1N)c1cc(-c3cccc(OC(F)(F)F)c3)ccc1CC21CCc2ccccc2CC1.
What is the InChIKey of CID 58197029?
The InChIKey is SEJLBMNPGJWZKM-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H26F3N3O2/c1-34-25(32)33-27(36-34)24-16-21(20-7-4-8-23(15-20)35-28(29,30)31)9-10-22(24)17-26(27)13-11-18-5-2-3-6-19(18)12-14-26/h2-10,15-16H,11-14,17H2,1H3,(H2,32,33).
What are the key properties of CID 58197029?
CID 58197029 has a molecular weight of 493.53 g/mol, XLogP of 5.72, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 58197029 is sourced from PubChem (CID 58197029), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).