C10H13BF6O4 — CID 162565379
CID 162565379 (PubChem CID 162565379) has the molecular formula C10H13BF6O4 and a molecular weight of 322.01 g/mol.
| Compound Name | CID 162565379 |
|---|---|
| PubChem CID | 162565379 |
| Molecular Formula | C10H13BF6O4 |
| Molecular Weight | 322.01 g/mol |
| Exact Mass | 322.08 |
| IUPAC Name | — |
| SMILES | [B]C(C)C[C@@H](OC(C)=O)[C@@H](O)C(O)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C10H13BF6O4/c1-4(11)3-6(21-5(2)18)7(19)8(20,9(12,13)14)10(15,16)17/h4,6-7,19-20H,3H2,1-2H3/t4?,6-,7-/m1/s1 |
| InChIKey | ZBKXOHDHIIVCCN-AMUJUKTHSA-N |
| XLogP | 1.50 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.01 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|