C15H23F3O2 — CID 10637388
[(5S,6R)-9,9-dimethyl-6-(trifluoromethyl)dec-7-yn-5-yl] acetate (PubChem CID 10637388) has the molecular formula C15H23F3O2 and a molecular weight of 292.34 g/mol. Its IUPAC name is [(5S,6R)-9,9-dimethyl-6-(trifluoromethyl)dec-7-yn-5-yl] acetate.
| Compound Name | [(5S,6R)-9,9-dimethyl-6-(trifluoromethyl)dec-7-yn-5-yl] acetate |
|---|---|
| PubChem CID | 10637388 |
| Molecular Formula | C15H23F3O2 |
| Molecular Weight | 292.34 g/mol |
| Exact Mass | 292.17 |
| IUPAC Name | [(5S,6R)-9,9-dimethyl-6-(trifluoromethyl)dec-7-yn-5-yl] acetate |
| SMILES | CCCC[C@H](OC(C)=O)[C@@H](C#CC(C)(C)C)C(F)(F)F |
| InChI | InChI=1S/C15H23F3O2/c1-6-7-8-13(20-11(2)19)12(15(16,17)18)9-10-14(3,4)5/h12-13H,6-8H2,1-5H3/t12-,13+/m1/s1 |
| InChIKey | BKZKAEVTGSFTCH-OLZOCXBDSA-N |
| XLogP | 4.34 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.34 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|