About chromium(2+);2-methanidyl-2-methylpropane;pentan-2-yl acetate
chromium(2+);2-methanidyl-2-methylpropane;pentan-2-yl acetate (PubChem CID 88738634) has the molecular formula C12H24CrO2
and a molecular weight of 252.32 g/mol. Its IUPAC name is chromium(2+);2-methanidyl-2-methylpropane;pentan-2-yl acetate.
Molecular Properties
| Compound Name | chromium(2+);2-methanidyl-2-methylpropane;pentan-2-yl acetate |
| PubChem CID | 88738634 |
| Molecular Formula | C12H24CrO2 |
| Molecular Weight | 252.32 g/mol |
| Exact Mass | 252.12 |
| IUPAC Name | chromium(2+);2-methanidyl-2-methylpropane;pentan-2-yl acetate |
| SMILES | [CH2-]C(C)(C)C.[CH2-]C(CCC)OC(C)=O.[Cr+2] |
| InChI | InChI=1S/C7H13O2.C5H11.Cr/c1-4-5-6(2)9-7(3)8;1-5(2,3)4;/h6H,2,4-5H2,1,3H3;1H2,2-4H3;/q2*-1;+2 |
| InChIKey | IMAJLHCNRWGZFW-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.32 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze chromium(2+);2-methanidyl-2-methylpropane;pentan-2-yl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chromium(2+);2-methanidyl-2-methylpropane;pentan-2-yl acetate?
The IUPAC name of chromium(2+);2-methanidyl-2-methylpropane;pentan-2-yl acetate (CID 88738634) is chromium(2+);2-methanidyl-2-methylpropane;pentan-2-yl acetate.
What is the SMILES notation for chromium(2+);2-methanidyl-2-methylpropane;pentan-2-yl acetate?
The canonical SMILES for chromium(2+);2-methanidyl-2-methylpropane;pentan-2-yl acetate is [CH2-]C(C)(C)C.[CH2-]C(CCC)OC(C)=O.[Cr+2].
What is the InChIKey of chromium(2+);2-methanidyl-2-methylpropane;pentan-2-yl acetate?
The InChIKey is IMAJLHCNRWGZFW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13O2.C5H11.Cr/c1-4-5-6(2)9-7(3)8;1-5(2,3)4;/h6H,2,4-5H2,1,3H3;1H2,2-4H3;/q2*-1;+2.
What are the key properties of chromium(2+);2-methanidyl-2-methylpropane;pentan-2-yl acetate?
chromium(2+);2-methanidyl-2-methylpropane;pentan-2-yl acetate has a molecular weight of 252.32 g/mol, XLogP of 3.42, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for chromium(2+);2-methanidyl-2-methylpropane;pentan-2-yl acetate is sourced from PubChem (CID 88738634), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).