C14H23F3O2 — CID 135667469
[(Z,5S,6S)-9-methyl-6-(trifluoromethyl)dec-7-en-5-yl] acetate (PubChem CID 135667469) has the molecular formula C14H23F3O2 and a molecular weight of 280.33 g/mol. Its IUPAC name is [(Z,5S,6S)-9-methyl-6-(trifluoromethyl)dec-7-en-5-yl] acetate.
| Compound Name | [(Z,5S,6S)-9-methyl-6-(trifluoromethyl)dec-7-en-5-yl] acetate |
|---|---|
| PubChem CID | 135667469 |
| Molecular Formula | C14H23F3O2 |
| Molecular Weight | 280.33 g/mol |
| Exact Mass | 280.17 |
| IUPAC Name | [(Z,5S,6S)-9-methyl-6-(trifluoromethyl)dec-7-en-5-yl] acetate |
| SMILES | CCCC[C@H](OC(C)=O)[C@H](/C=C\C(C)C)C(F)(F)F |
| InChI | InChI=1S/C14H23F3O2/c1-5-6-7-13(19-11(4)18)12(14(15,16)17)9-8-10(2)3/h8-10,12-13H,5-7H2,1-4H3/b9-8-/t12-,13-/m0/s1 |
| InChIKey | XKDGCBAXQGQTAB-MYSQMOAQSA-N |
| XLogP | 4.50 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.33 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|