C24H25F3O3 — CID 10502120
[(4R,5S)-1-phenylmethoxy-4-(trifluoromethyl)non-2-yn-5-yl] benzoate (PubChem CID 10502120) has the molecular formula C24H25F3O3 and a molecular weight of 418.46 g/mol. Its IUPAC name is [(4R,5S)-1-phenylmethoxy-4-(trifluoromethyl)non-2-yn-5-yl] benzoate.
| Compound Name | [(4R,5S)-1-phenylmethoxy-4-(trifluoromethyl)non-2-yn-5-yl] benzoate |
|---|---|
| PubChem CID | 10502120 |
| Molecular Formula | C24H25F3O3 |
| Molecular Weight | 418.46 g/mol |
| Exact Mass | 418.18 |
| IUPAC Name | [(4R,5S)-1-phenylmethoxy-4-(trifluoromethyl)non-2-yn-5-yl] benzoate |
| SMILES | CCCC[C@H](OC(=O)c1ccccc1)[C@@H](C#CCOCc1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C24H25F3O3/c1-2-3-16-22(30-23(28)20-13-8-5-9-14-20)21(24(25,26)27)15-10-17-29-18-19-11-6-4-7-12-19/h4-9,11-14,21-22H,2-3,16-18H2,1H3/t21-,22+/m1/s1 |
| InChIKey | OLVOQIGBTUBMAL-YADHBBJMSA-N |
| XLogP | 5.80 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.46 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|