C21H23ClF2N4O3 — CID 162566349
5-chloro-N-[1-[6-(2,2-difluoro-3-methylbut-3-enoxy)-3-pyridinyl]ethyl]-2-(propanoylamino)pyridine-4-carboxamide (PubChem CID 162566349) has the molecular formula C21H23ClF2N4O3 and a molecular weight of 452.89 g/mol. Its IUPAC name is 5-chloro-N-[1-[6-(2,2-difluoro-3-methylbut-3-enoxy)-3-pyridinyl]ethyl]-2-(propanoylamino)pyridine-4-carboxamide.
| Compound Name | 5-chloro-N-[1-[6-(2,2-difluoro-3-methylbut-3-enoxy)-3-pyridinyl]ethyl]-2-(propanoylamino)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 162566349 |
| Molecular Formula | C21H23ClF2N4O3 |
| Molecular Weight | 452.89 g/mol |
| Exact Mass | 452.14 |
| IUPAC Name | 5-chloro-N-[1-[6-(2,2-difluoro-3-methylbut-3-enoxy)-3-pyridinyl]ethyl]-2-(propanoylamino)pyridine-4-carboxamide |
| SMILES | C=C(C)C(F)(F)COc1ccc(C(C)NC(=O)c2cc(NC(=O)CC)ncc2Cl)cn1 |
| InChI | InChI=1S/C21H23ClF2N4O3/c1-5-18(29)28-17-8-15(16(22)10-25-17)20(30)27-13(4)14-6-7-19(26-9-14)31-11-21(23,24)12(2)3/h6-10,13H,2,5,11H2,1,3-4H3,(H,27,30)(H,25,28,29) |
| InChIKey | YUWZKHZCKPWLAY-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.89 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|