About trifluoromethyl 2H-pyrimidine-1-carboxylate
trifluoromethyl 2H-pyrimidine-1-carboxylate (PubChem CID 162572446) has the molecular formula C6H5F3N2O2
and a molecular weight of 194.11 g/mol. Its IUPAC name is trifluoromethyl 2H-pyrimidine-1-carboxylate.
Molecular Properties
| Compound Name | trifluoromethyl 2H-pyrimidine-1-carboxylate |
| PubChem CID | 162572446 |
| Molecular Formula | C6H5F3N2O2 |
| Molecular Weight | 194.11 g/mol |
| Exact Mass | 194.03 |
| IUPAC Name | trifluoromethyl 2H-pyrimidine-1-carboxylate |
| SMILES | O=C(OC(F)(F)F)N1C=CC=NC1 |
| InChI | InChI=1S/C6H5F3N2O2/c7-6(8,9)13-5(12)11-3-1-2-10-4-11/h1-3H,4H2 |
| InChIKey | RIWBJEXNBRUTGC-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.11 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze trifluoromethyl 2H-pyrimidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trifluoromethyl 2H-pyrimidine-1-carboxylate?
The IUPAC name of trifluoromethyl 2H-pyrimidine-1-carboxylate (CID 162572446) is trifluoromethyl 2H-pyrimidine-1-carboxylate.
What is the SMILES notation for trifluoromethyl 2H-pyrimidine-1-carboxylate?
The canonical SMILES for trifluoromethyl 2H-pyrimidine-1-carboxylate is O=C(OC(F)(F)F)N1C=CC=NC1.
What is the InChIKey of trifluoromethyl 2H-pyrimidine-1-carboxylate?
The InChIKey is RIWBJEXNBRUTGC-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5F3N2O2/c7-6(8,9)13-5(12)11-3-1-2-10-4-11/h1-3H,4H2.
What are the key properties of trifluoromethyl 2H-pyrimidine-1-carboxylate?
trifluoromethyl 2H-pyrimidine-1-carboxylate has a molecular weight of 194.11 g/mol, XLogP of 1.50, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for trifluoromethyl 2H-pyrimidine-1-carboxylate is sourced from PubChem (CID 162572446), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).