C28H36F6N6O4 — CID 162578707
[(2S)-1-[5-[3,5-bis(trifluoromethyl)phenyl]-1,2-dihydroimidazol-3-yl]-3,3-dimethylbutan-2-yl] N-[(2S,3S)-2-hydroxy-1-oxo-1-(1H-pyrazol-5-ylamino)heptan-3-yl]carbamate (PubChem CID 162578707) has the molecular formula C28H36F6N6O4 and a molecular weight of 634.62 g/mol. Its IUPAC name is [(2S)-1-[5-[3,5-bis(trifluoromethyl)phenyl]-1,2-dihydroimidazol-3-yl]-3,3-dimethylbutan-2-yl] N-[(2S,3S)-2-hydroxy-1-oxo-1-(1H-pyrazol-5-ylamino)heptan-3-yl]carbamate.
| Compound Name | [(2S)-1-[5-[3,5-bis(trifluoromethyl)phenyl]-1,2-dihydroimidazol-3-yl]-3,3-dimethylbutan-2-yl] N-[(2S,3S)-2-hydroxy-1-oxo-1-(1H-pyrazol-5-ylamino)heptan-3-yl]carbamate |
|---|---|
| PubChem CID | 162578707 |
| Molecular Formula | C28H36F6N6O4 |
| Molecular Weight | 634.62 g/mol |
| Exact Mass | 634.27 |
| IUPAC Name | [(2S)-1-[5-[3,5-bis(trifluoromethyl)phenyl]-1,2-dihydroimidazol-3-yl]-3,3-dimethylbutan-2-yl] N-[(2S,3S)-2-hydroxy-1-oxo-1-(1H-pyrazol-5-ylamino)heptan-3-yl]carbamate |
| SMILES | CCCC[C@H](NC(=O)O[C@H](CN1C=C(c2cc(C(F)(F)F)cc(C(F)(F)F)c2)NC1)C(C)(C)C)[C@H](O)C(=O)Nc1ccn[nH]1 |
| InChI | InChI=1S/C28H36F6N6O4/c1-5-6-7-19(23(41)24(42)38-22-8-9-36-39-22)37-25(43)44-21(26(2,3)4)14-40-13-20(35-15-40)16-10-17(27(29,30)31)12-18(11-16)28(32,33)34/h8-13,19,21,23,35,41H,5-7,14-15H2,1-4H3,(H,37,43)(H2,36,38,39,42)/t19-,21+,23-/m0/s1 |
| InChIKey | AGWQKXYNXJBYCQ-WPYKKVEZSA-N |
| XLogP | 5.31 |
| TPSA | 131.61 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.62 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |