C10H6F3NO2S — CID 162579397
5-[3-(trifluoromethyl)phenyl]-1,2-thiazole 1,1-dioxide (PubChem CID 162579397) has the molecular formula C10H6F3NO2S and a molecular weight of 261.22 g/mol. Its IUPAC name is 5-[3-(trifluoromethyl)phenyl]-1,2-thiazole 1,1-dioxide.
| Compound Name | 5-[3-(trifluoromethyl)phenyl]-1,2-thiazole 1,1-dioxide |
|---|---|
| PubChem CID | 162579397 |
| Molecular Formula | C10H6F3NO2S |
| Molecular Weight | 261.22 g/mol |
| Exact Mass | 261.01 |
| IUPAC Name | 5-[3-(trifluoromethyl)phenyl]-1,2-thiazole 1,1-dioxide |
| SMILES | O=S1(=O)N=CC=C1c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C10H6F3NO2S/c11-10(12,13)8-3-1-2-7(6-8)9-4-5-14-17(9,15)16/h1-6H |
| InChIKey | YQAPRABZKDYVRW-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 46.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.22 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |