C9H6F4INO — CID 162579994
3-fluoro-N-(iodomethyl)-4-(trifluoromethyl)benzamide (PubChem CID 162579994) has the molecular formula C9H6F4INO and a molecular weight of 347.05 g/mol. Its IUPAC name is 3-fluoro-N-(iodomethyl)-4-(trifluoromethyl)benzamide.
| Compound Name | 3-fluoro-N-(iodomethyl)-4-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 162579994 |
| Molecular Formula | C9H6F4INO |
| Molecular Weight | 347.05 g/mol |
| Exact Mass | 346.94 |
| IUPAC Name | 3-fluoro-N-(iodomethyl)-4-(trifluoromethyl)benzamide |
| SMILES | O=C(NCI)c1ccc(C(F)(F)F)c(F)c1 |
| InChI | InChI=1S/C9H6F4INO/c10-7-3-5(8(16)15-4-14)1-2-6(7)9(11,12)13/h1-3H,4H2,(H,15,16) |
| InChIKey | HYWDXQBDHVZAAS-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.05 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|