C16H10F3N3 — CID 162580055
1-(1H-benzimidazol-2-yl)-N-[[2-(trifluoromethyl)cyclohexa-1,5-dien-3-yn-1-yl]methyl]methanimine (PubChem CID 162580055) has the molecular formula C16H10F3N3 and a molecular weight of 301.27 g/mol. Its IUPAC name is 1-(1H-benzimidazol-2-yl)-N-[[2-(trifluoromethyl)cyclohexa-1,5-dien-3-yn-1-yl]methyl]methanimine.
| Compound Name | 1-(1H-benzimidazol-2-yl)-N-[[2-(trifluoromethyl)cyclohexa-1,5-dien-3-yn-1-yl]methyl]methanimine |
|---|---|
| PubChem CID | 162580055 |
| Molecular Formula | C16H10F3N3 |
| Molecular Weight | 301.27 g/mol |
| Exact Mass | 301.08 |
| IUPAC Name | 1-(1H-benzimidazol-2-yl)-N-[[2-(trifluoromethyl)cyclohexa-1,5-dien-3-yn-1-yl]methyl]methanimine |
| SMILES | FC(F)(F)c1c#cccc1C/N=C/c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C16H10F3N3/c17-16(18,19)12-6-2-1-5-11(12)9-20-10-15-21-13-7-3-4-8-14(13)22-15/h1,3-5,7-8,10H,9H2,(H,21,22)/b20-10+ |
| InChIKey | VVADUYYREZRTMO-KEBDBYFISA-N |
| XLogP | 3.80 |
| TPSA | 41.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.27 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|