C20H20F4N2O4S2 — CID 162581564
2-[3-[(2R)-4-[3-fluoro-4-(trifluoromethyl)phenyl]-2-methyl-2-sulfanylpiperazin-1-yl]sulfonylphenyl]acetic acid (PubChem CID 162581564) has the molecular formula C20H20F4N2O4S2 and a molecular weight of 492.52 g/mol. Its IUPAC name is 2-[3-[(2R)-4-[3-fluoro-4-(trifluoromethyl)phenyl]-2-methyl-2-sulfanylpiperazin-1-yl]sulfonylphenyl]acetic acid.
| Compound Name | 2-[3-[(2R)-4-[3-fluoro-4-(trifluoromethyl)phenyl]-2-methyl-2-sulfanylpiperazin-1-yl]sulfonylphenyl]acetic acid |
|---|---|
| PubChem CID | 162581564 |
| Molecular Formula | C20H20F4N2O4S2 |
| Molecular Weight | 492.52 g/mol |
| Exact Mass | 492.08 |
| IUPAC Name | 2-[3-[(2R)-4-[3-fluoro-4-(trifluoromethyl)phenyl]-2-methyl-2-sulfanylpiperazin-1-yl]sulfonylphenyl]acetic acid |
| SMILES | C[C@@]1(S)CN(c2ccc(C(F)(F)F)c(F)c2)CCN1S(=O)(=O)c1cccc(CC(=O)O)c1 |
| InChI | InChI=1S/C20H20F4N2O4S2/c1-19(31)12-25(14-5-6-16(17(21)11-14)20(22,23)24)7-8-26(19)32(29,30)15-4-2-3-13(9-15)10-18(27)28/h2-6,9,11,31H,7-8,10,12H2,1H3,(H,27,28)/t19-/m1/s1 |
| InChIKey | OZELTSMLAPEXOM-LJQANCHMSA-N |
| XLogP | 3.63 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.52 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|