C19H22F3N6O3S+ — CID 162582241
methyl-[4-morpholin-4-yl-3-[4-[5-(trifluoromethyl)-1,3,4-thiadiazol-2-yl]piperazine-1-carbonyl]phenyl]-oxoazanium (PubChem CID 162582241) has the molecular formula C19H22F3N6O3S+ and a molecular weight of 471.49 g/mol. Its IUPAC name is methyl-[4-morpholin-4-yl-3-[4-[5-(trifluoromethyl)-1,3,4-thiadiazol-2-yl]piperazine-1-carbonyl]phenyl]-oxoazanium.
| Compound Name | methyl-[4-morpholin-4-yl-3-[4-[5-(trifluoromethyl)-1,3,4-thiadiazol-2-yl]piperazine-1-carbonyl]phenyl]-oxoazanium |
|---|---|
| PubChem CID | 162582241 |
| Molecular Formula | C19H22F3N6O3S+ |
| Molecular Weight | 471.49 g/mol |
| Exact Mass | 471.14 |
| IUPAC Name | methyl-[4-morpholin-4-yl-3-[4-[5-(trifluoromethyl)-1,3,4-thiadiazol-2-yl]piperazine-1-carbonyl]phenyl]-oxoazanium |
| SMILES | C[N+](=O)c1ccc(N2CCOCC2)c(C(=O)N2CCN(c3nnc(C(F)(F)F)s3)CC2)c1 |
| InChI | InChI=1S/C19H22F3N6O3S/c1-25(30)13-2-3-15(26-8-10-31-11-9-26)14(12-13)16(29)27-4-6-28(7-5-27)18-24-23-17(32-18)19(20,21)22/h2-3,12H,4-11H2,1H3/q+1 |
| InChIKey | MHOXFEZRWNARAL-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 81.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.49 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|