C33H34Br2F6N6O4 — CID 160676351
1-[2-bromo-5-(trifluoromethyl)phenyl]piperazine;[4-[2-bromo-5-(trifluoromethyl)phenyl]piperazin-1-yl]-(2-morpholin-4-yl-5-nitrophenyl)methanone (PubChem CID 160676351) has the molecular formula C33H34Br2F6N6O4 and a molecular weight of 852.47 g/mol. Its IUPAC name is 1-[2-bromo-5-(trifluoromethyl)phenyl]piperazine;[4-[2-bromo-5-(trifluoromethyl)phenyl]piperazin-1-yl]-(2-morpholin-4-yl-5-nitrophenyl)methanone.
| Compound Name | 1-[2-bromo-5-(trifluoromethyl)phenyl]piperazine;[4-[2-bromo-5-(trifluoromethyl)phenyl]piperazin-1-yl]-(2-morpholin-4-yl-5-nitrophenyl)methanone |
|---|---|
| PubChem CID | 160676351 |
| Molecular Formula | C33H34Br2F6N6O4 |
| Molecular Weight | 852.47 g/mol |
| Exact Mass | 850.09 |
| IUPAC Name | 1-[2-bromo-5-(trifluoromethyl)phenyl]piperazine;[4-[2-bromo-5-(trifluoromethyl)phenyl]piperazin-1-yl]-(2-morpholin-4-yl-5-nitrophenyl)methanone |
| SMILES | FC(F)(F)c1ccc(Br)c(N2CCNCC2)c1.O=C(c1cc([N+](=O)[O-])ccc1N1CCOCC1)N1CCN(c2cc(C(F)(F)F)ccc2Br)CC1 |
| InChI | InChI=1S/C22H22BrF3N4O4.C11H12BrF3N2/c23-18-3-1-15(22(24,25)26)13-20(18)27-5-7-29(8-6-27)21(31)17-14-16(30(32)33)2-4-19(17)28-9-11-34-12-10-28;12-9-2-1-8(11(13,14)15)7-10(9)17-5-3-16-4-6-17/h1-4,13-14H,5-12H2;1-2,7,16H,3-6H2 |
| InChIKey | RNOQNYLFOARDJM-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 94.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 852.47 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|