C21H22F3N5O4 — CID 30096157
(2-morpholin-4-yl-3-pyridinyl)-[4-[2-nitro-4-(trifluoromethyl)phenyl]piperazin-1-yl]methanone (PubChem CID 30096157) has the molecular formula C21H22F3N5O4 and a molecular weight of 465.43 g/mol. Its IUPAC name is (2-morpholin-4-yl-3-pyridinyl)-[4-[2-nitro-4-(trifluoromethyl)phenyl]piperazin-1-yl]methanone.
| Compound Name | (2-morpholin-4-yl-3-pyridinyl)-[4-[2-nitro-4-(trifluoromethyl)phenyl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 30096157 |
| Molecular Formula | C21H22F3N5O4 |
| Molecular Weight | 465.43 g/mol |
| Exact Mass | 465.16 |
| IUPAC Name | (2-morpholin-4-yl-3-pyridinyl)-[4-[2-nitro-4-(trifluoromethyl)phenyl]piperazin-1-yl]methanone |
| SMILES | O=C(c1cccnc1N1CCOCC1)N1CCN(c2ccc(C(F)(F)F)cc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C21H22F3N5O4/c22-21(23,24)15-3-4-17(18(14-15)29(31)32)26-6-8-28(9-7-26)20(30)16-2-1-5-25-19(16)27-10-12-33-13-11-27/h1-5,14H,6-13H2 |
| InChIKey | URNXKMUBXCNKIS-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 92.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.43 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|