C12H10F3NOS — CID 162582506
4-(5-methylcyclohexa-1,3-dien-1-yl)-5-(trifluoromethyl)-1,3-thiazole-2-carbaldehyde (PubChem CID 162582506) has the molecular formula C12H10F3NOS and a molecular weight of 273.28 g/mol. Its IUPAC name is 4-(5-methylcyclohexa-1,3-dien-1-yl)-5-(trifluoromethyl)-1,3-thiazole-2-carbaldehyde.
| Compound Name | 4-(5-methylcyclohexa-1,3-dien-1-yl)-5-(trifluoromethyl)-1,3-thiazole-2-carbaldehyde |
|---|---|
| PubChem CID | 162582506 |
| Molecular Formula | C12H10F3NOS |
| Molecular Weight | 273.28 g/mol |
| Exact Mass | 273.04 |
| IUPAC Name | 4-(5-methylcyclohexa-1,3-dien-1-yl)-5-(trifluoromethyl)-1,3-thiazole-2-carbaldehyde |
| SMILES | CC1C=CC=C(c2nc(C=O)sc2C(F)(F)F)C1 |
| InChI | InChI=1S/C12H10F3NOS/c1-7-3-2-4-8(5-7)10-11(12(13,14)15)18-9(6-17)16-10/h2-4,6-7H,5H2,1H3 |
| InChIKey | IKGKAODZLPPZIJ-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.28 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|