C14H15F2NO3 — CID 162582964
(4S)-4-(2,2-difluoroethenyl)-1-[(2-hydroxy-4-methoxyphenyl)methyl]pyrrolidin-2-one (PubChem CID 162582964) has the molecular formula C14H15F2NO3 and a molecular weight of 283.27 g/mol. Its IUPAC name is (4S)-4-(2,2-difluoroethenyl)-1-[(2-hydroxy-4-methoxyphenyl)methyl]pyrrolidin-2-one.
| Compound Name | (4S)-4-(2,2-difluoroethenyl)-1-[(2-hydroxy-4-methoxyphenyl)methyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 162582964 |
| Molecular Formula | C14H15F2NO3 |
| Molecular Weight | 283.27 g/mol |
| Exact Mass | 283.10 |
| IUPAC Name | (4S)-4-(2,2-difluoroethenyl)-1-[(2-hydroxy-4-methoxyphenyl)methyl]pyrrolidin-2-one |
| SMILES | COc1ccc(CN2C[C@H](C=C(F)F)CC2=O)c(O)c1 |
| InChI | InChI=1S/C14H15F2NO3/c1-20-11-3-2-10(12(18)6-11)8-17-7-9(4-13(15)16)5-14(17)19/h2-4,6,9,18H,5,7-8H2,1H3/t9-/m1/s1 |
| InChIKey | SVBCAEXNRJPCMG-SECBINFHSA-N |
| XLogP | 2.53 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.27 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|