C11H13F4NO2 — CID 162583587
N-(1-ethoxy-2,2,2-trifluoroethyl)-3-fluoro-4-methoxyaniline (PubChem CID 162583587) has the molecular formula C11H13F4NO2 and a molecular weight of 267.22 g/mol. Its IUPAC name is N-(1-ethoxy-2,2,2-trifluoroethyl)-3-fluoro-4-methoxyaniline.
| Compound Name | N-(1-ethoxy-2,2,2-trifluoroethyl)-3-fluoro-4-methoxyaniline |
|---|---|
| PubChem CID | 162583587 |
| Molecular Formula | C11H13F4NO2 |
| Molecular Weight | 267.22 g/mol |
| Exact Mass | 267.09 |
| IUPAC Name | N-(1-ethoxy-2,2,2-trifluoroethyl)-3-fluoro-4-methoxyaniline |
| SMILES | CCOC(Nc1ccc(OC)c(F)c1)C(F)(F)F |
| InChI | InChI=1S/C11H13F4NO2/c1-3-18-10(11(13,14)15)16-7-4-5-9(17-2)8(12)6-7/h4-6,10,16H,3H2,1-2H3 |
| InChIKey | JVEZERXAAGFMGG-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.22 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|