C15H13ClF3NO3 — CID 162584494
methyl (6S)-6-[4-chloro-3-(trifluoromethyl)phenyl]-2-oxo-3-azabicyclo[4.1.0]heptane-1-carboxylate (PubChem CID 162584494) has the molecular formula C15H13ClF3NO3 and a molecular weight of 347.72 g/mol. Its IUPAC name is methyl (6S)-6-[4-chloro-3-(trifluoromethyl)phenyl]-2-oxo-3-azabicyclo[4.1.0]heptane-1-carboxylate.
| Compound Name | methyl (6S)-6-[4-chloro-3-(trifluoromethyl)phenyl]-2-oxo-3-azabicyclo[4.1.0]heptane-1-carboxylate |
|---|---|
| PubChem CID | 162584494 |
| Molecular Formula | C15H13ClF3NO3 |
| Molecular Weight | 347.72 g/mol |
| Exact Mass | 347.05 |
| IUPAC Name | methyl (6S)-6-[4-chloro-3-(trifluoromethyl)phenyl]-2-oxo-3-azabicyclo[4.1.0]heptane-1-carboxylate |
| SMILES | COC(=O)C12C[C@@]1(c1ccc(Cl)c(C(F)(F)F)c1)CCNC2=O |
| InChI | InChI=1S/C15H13ClF3NO3/c1-23-12(22)14-7-13(14,4-5-20-11(14)21)8-2-3-10(16)9(6-8)15(17,18)19/h2-3,6H,4-5,7H2,1H3,(H,20,21)/t13-,14?/m1/s1 |
| InChIKey | SSZUGAKMABITMZ-KWCCSABGSA-N |
| XLogP | 2.68 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.72 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|