C25H17F4N3O — CID 162584627
4-[(3R)-3-(4-fluorophenyl)-7-hydroxy-3,3a,4,5-tetrahydrobenzo[g]indazol-2-yl]-2-(trifluoromethyl)benzonitrile (PubChem CID 162584627) has the molecular formula C25H17F4N3O and a molecular weight of 451.42 g/mol. Its IUPAC name is 4-[(3R)-3-(4-fluorophenyl)-7-hydroxy-3,3a,4,5-tetrahydrobenzo[g]indazol-2-yl]-2-(trifluoromethyl)benzonitrile.
| Compound Name | 4-[(3R)-3-(4-fluorophenyl)-7-hydroxy-3,3a,4,5-tetrahydrobenzo[g]indazol-2-yl]-2-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 162584627 |
| Molecular Formula | C25H17F4N3O |
| Molecular Weight | 451.42 g/mol |
| Exact Mass | 451.13 |
| IUPAC Name | 4-[(3R)-3-(4-fluorophenyl)-7-hydroxy-3,3a,4,5-tetrahydrobenzo[g]indazol-2-yl]-2-(trifluoromethyl)benzonitrile |
| SMILES | N#Cc1ccc(N2N=C3c4ccc(O)cc4CCC3[C@@H]2c2ccc(F)cc2)cc1C(F)(F)F |
| InChI | InChI=1S/C25H17F4N3O/c26-17-5-1-14(2-6-17)24-21-9-4-15-11-19(33)8-10-20(15)23(21)31-32(24)18-7-3-16(13-30)22(12-18)25(27,28)29/h1-3,5-8,10-12,21,24,33H,4,9H2/t21?,24-/m0/s1 |
| InChIKey | NCHUGOJKQNXOLK-FHZUCYEKSA-N |
| XLogP | 5.95 |
| TPSA | 59.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.42 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'} |
|---|