C27H22FN3O2 — CID 143664514
4-(4-cyano-3-methylphenyl)-5-(4-fluorophenyl)-3,4-diazatricyclo[8.4.0.02,6]tetradeca-1(10),2,11,13-tetraene-12-carboxylic acid (PubChem CID 143664514) has the molecular formula C27H22FN3O2 and a molecular weight of 439.49 g/mol. Its IUPAC name is 4-(4-cyano-3-methylphenyl)-5-(4-fluorophenyl)-3,4-diazatricyclo[8.4.0.02,6]tetradeca-1(10),2,11,13-tetraene-12-carboxylic acid.
| Compound Name | 4-(4-cyano-3-methylphenyl)-5-(4-fluorophenyl)-3,4-diazatricyclo[8.4.0.02,6]tetradeca-1(10),2,11,13-tetraene-12-carboxylic acid |
|---|---|
| PubChem CID | 143664514 |
| Molecular Formula | C27H22FN3O2 |
| Molecular Weight | 439.49 g/mol |
| Exact Mass | 439.17 |
| IUPAC Name | 4-(4-cyano-3-methylphenyl)-5-(4-fluorophenyl)-3,4-diazatricyclo[8.4.0.02,6]tetradeca-1(10),2,11,13-tetraene-12-carboxylic acid |
| SMILES | Cc1cc(N2N=C3c4ccc(C(=O)O)cc4CCCC3C2c2ccc(F)cc2)ccc1C#N |
| InChI | InChI=1S/C27H22FN3O2/c1-16-13-22(11-7-20(16)15-29)31-26(17-5-9-21(28)10-6-17)24-4-2-3-18-14-19(27(32)33)8-12-23(18)25(24)30-31/h5-14,24,26H,2-4H2,1H3,(H,32,33) |
| InChIKey | ZAKNIKFEZBDIGE-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 76.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.49 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |